C22H20FNO5S2 — CID 110166005
3-(4-fluorophenyl)-N-(4-methylsulfonylphenyl)sulfonyl-2-phenylpropanamide (PubChem CID 110166005) has the molecular formula C22H20FNO5S2 and a molecular weight of 461.54 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(4-methylsulfonylphenyl)sulfonyl-2-phenylpropanamide.
| Compound Name | 3-(4-fluorophenyl)-N-(4-methylsulfonylphenyl)sulfonyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 110166005 |
| Molecular Formula | C22H20FNO5S2 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(4-methylsulfonylphenyl)sulfonyl-2-phenylpropanamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NC(=O)C(Cc2ccc(F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20FNO5S2/c1-30(26,27)19-11-13-20(14-12-19)31(28,29)24-22(25)21(17-5-3-2-4-6-17)15-16-7-9-18(23)10-8-16/h2-14,21H,15H2,1H3,(H,24,25) |
| InChIKey | HVJIJJFLDWUALA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |