C22H17F4NO3S — CID 129453548
(2S)-3-(4-fluorophenyl)-2-phenyl-N-[3-(trifluoromethyl)phenyl]sulfonylpropanamide (PubChem CID 129453548) has the molecular formula C22H17F4NO3S and a molecular weight of 451.44 g/mol. Its IUPAC name is (2S)-3-(4-fluorophenyl)-2-phenyl-N-[3-(trifluoromethyl)phenyl]sulfonylpropanamide.
| Compound Name | (2S)-3-(4-fluorophenyl)-2-phenyl-N-[3-(trifluoromethyl)phenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 129453548 |
| Molecular Formula | C22H17F4NO3S |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | (2S)-3-(4-fluorophenyl)-2-phenyl-N-[3-(trifluoromethyl)phenyl]sulfonylpropanamide |
| SMILES | O=C(NS(=O)(=O)c1cccc(C(F)(F)F)c1)[C@@H](Cc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H17F4NO3S/c23-18-11-9-15(10-12-18)13-20(16-5-2-1-3-6-16)21(28)27-31(29,30)19-8-4-7-17(14-19)22(24,25)26/h1-12,14,20H,13H2,(H,27,28)/t20-/m0/s1 |
| InChIKey | AZPWGAFDCWVWQP-FQEVSTJZSA-N |
| XLogP | 4.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |