C9H9F3N2O3S — CID 23548404
1-methyl-3-[3-(trifluoromethyl)phenyl]sulfonylurea (PubChem CID 23548404) has the molecular formula C9H9F3N2O3S and a molecular weight of 282.24 g/mol. Its IUPAC name is 1-methyl-3-[3-(trifluoromethyl)phenyl]sulfonylurea.
| Compound Name | 1-methyl-3-[3-(trifluoromethyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 23548404 |
| Molecular Formula | C9H9F3N2O3S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-methyl-3-[3-(trifluoromethyl)phenyl]sulfonylurea |
| SMILES | CNC(=O)NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H9F3N2O3S/c1-13-8(15)14-18(16,17)7-4-2-3-6(5-7)9(10,11)12/h2-5H,1H3,(H2,13,14,15) |
| InChIKey | UPQOHWHEGMWTTB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |