C19H15F3N2O3S — CID 110166762
4-methyl-3-pyrrol-1-yl-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide (PubChem CID 110166762) has the molecular formula C19H15F3N2O3S and a molecular weight of 408.40 g/mol. Its IUPAC name is 4-methyl-3-pyrrol-1-yl-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide.
| Compound Name | 4-methyl-3-pyrrol-1-yl-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 110166762 |
| Molecular Formula | C19H15F3N2O3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-methyl-3-pyrrol-1-yl-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1-n1cccc1 |
| InChI | InChI=1S/C19H15F3N2O3S/c1-13-7-8-14(11-17(13)24-9-2-3-10-24)18(25)23-28(26,27)16-6-4-5-15(12-16)19(20,21)22/h2-12H,1H3,(H,23,25) |
| InChIKey | NXBYSULMLVUXTD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |