C15H17N3O3 — CID 43042123
ethyl N-[(4-methyl-3-pyrrol-1-ylbenzoyl)amino]carbamate (PubChem CID 43042123) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl N-[(4-methyl-3-pyrrol-1-ylbenzoyl)amino]carbamate.
| Compound Name | ethyl N-[(4-methyl-3-pyrrol-1-ylbenzoyl)amino]carbamate |
|---|---|
| PubChem CID | 43042123 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl N-[(4-methyl-3-pyrrol-1-ylbenzoyl)amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1ccc(C)c(-n2cccc2)c1 |
| InChI | InChI=1S/C15H17N3O3/c1-3-21-15(20)17-16-14(19)12-7-6-11(2)13(10-12)18-8-4-5-9-18/h4-10H,3H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | YUDUOLSXQOUPIX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|