C15H14N2O — CID 18156699
4-methyl-N-prop-2-ynyl-3-pyrrol-1-ylbenzamide (PubChem CID 18156699) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-methyl-N-prop-2-ynyl-3-pyrrol-1-ylbenzamide.
| Compound Name | 4-methyl-N-prop-2-ynyl-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 18156699 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-methyl-N-prop-2-ynyl-3-pyrrol-1-ylbenzamide |
| SMILES | C#CCNC(=O)c1ccc(C)c(-n2cccc2)c1 |
| InChI | InChI=1S/C15H14N2O/c1-3-8-16-15(18)13-7-6-12(2)14(11-13)17-9-4-5-10-17/h1,4-7,9-11H,8H2,2H3,(H,16,18) |
| InChIKey | VYYZADIOQITGQT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|