C23H23N3O2 — CID 24597417
N-[[3-(cyclopropanecarbonylamino)phenyl]methyl]-4-methyl-3-pyrrol-1-ylbenzamide (PubChem CID 24597417) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[[3-(cyclopropanecarbonylamino)phenyl]methyl]-4-methyl-3-pyrrol-1-ylbenzamide.
| Compound Name | N-[[3-(cyclopropanecarbonylamino)phenyl]methyl]-4-methyl-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 24597417 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[[3-(cyclopropanecarbonylamino)phenyl]methyl]-4-methyl-3-pyrrol-1-ylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2cccc(NC(=O)C3CC3)c2)cc1-n1cccc1 |
| InChI | InChI=1S/C23H23N3O2/c1-16-7-8-19(14-21(16)26-11-2-3-12-26)22(27)24-15-17-5-4-6-20(13-17)25-23(28)18-9-10-18/h2-8,11-14,18H,9-10,15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | XOHZMFQWMBZEPQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |