C19H21N3O4S — CID 17491912
N-[[3-(cyclopropanecarbonylamino)phenyl]methyl]-3-(methylsulfamoyl)benzamide (PubChem CID 17491912) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[[3-(cyclopropanecarbonylamino)phenyl]methyl]-3-(methylsulfamoyl)benzamide.
| Compound Name | N-[[3-(cyclopropanecarbonylamino)phenyl]methyl]-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 17491912 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[[3-(cyclopropanecarbonylamino)phenyl]methyl]-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)NCc2cccc(NC(=O)C3CC3)c2)c1 |
| InChI | InChI=1S/C19H21N3O4S/c1-20-27(25,26)17-7-3-5-15(11-17)18(23)21-12-13-4-2-6-16(10-13)22-19(24)14-8-9-14/h2-7,10-11,14,20H,8-9,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | JBCWUASUTDRIAE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |