C20H23N3O4S — CID 55656434
3-[(2-methylcyclopropanecarbonyl)amino]-N-[[3-(methylsulfamoyl)phenyl]methyl]benzamide (PubChem CID 55656434) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[(2-methylcyclopropanecarbonyl)amino]-N-[[3-(methylsulfamoyl)phenyl]methyl]benzamide.
| Compound Name | 3-[(2-methylcyclopropanecarbonyl)amino]-N-[[3-(methylsulfamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55656434 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[(2-methylcyclopropanecarbonyl)amino]-N-[[3-(methylsulfamoyl)phenyl]methyl]benzamide |
| SMILES | CNS(=O)(=O)c1cccc(CNC(=O)c2cccc(NC(=O)C3CC3C)c2)c1 |
| InChI | InChI=1S/C20H23N3O4S/c1-13-9-18(13)20(25)23-16-7-4-6-15(11-16)19(24)22-12-14-5-3-8-17(10-14)28(26,27)21-2/h3-8,10-11,13,18,21H,9,12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | YXMGOSGHEFGXTR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |