C12H14N4O4 — CID 86844759
ethyl N-[(1-methyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]carbamate (PubChem CID 86844759) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is ethyl N-[(1-methyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]carbamate.
| Compound Name | ethyl N-[(1-methyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]carbamate |
|---|---|
| PubChem CID | 86844759 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | ethyl N-[(1-methyl-2-oxo-3H-benzimidazole-5-carbonyl)amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1ccc2c(c1)[nH]c(=O)n2C |
| InChI | InChI=1S/C12H14N4O4/c1-3-20-12(19)15-14-10(17)7-4-5-9-8(6-7)13-11(18)16(9)2/h4-6H,3H2,1-2H3,(H,13,18)(H,14,17)(H,15,19) |
| InChIKey | FKNUKHDBXYRLEO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|