C14H18N2O4 — CID 71875468
3-ethoxypropyl 1-methyl-2-oxo-3H-benzimidazole-5-carboxylate (PubChem CID 71875468) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-ethoxypropyl 1-methyl-2-oxo-3H-benzimidazole-5-carboxylate.
| Compound Name | 3-ethoxypropyl 1-methyl-2-oxo-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 71875468 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-ethoxypropyl 1-methyl-2-oxo-3H-benzimidazole-5-carboxylate |
| SMILES | CCOCCCOC(=O)c1ccc2c(c1)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H18N2O4/c1-3-19-7-4-8-20-13(17)10-5-6-12-11(9-10)15-14(18)16(12)2/h5-6,9H,3-4,7-8H2,1-2H3,(H,15,18) |
| InChIKey | GYDMCCIKEPHBAX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|