C14H19N3O3 — CID 70707341
1-(2-ethoxyethyl)-N,N-dimethyl-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 70707341) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-N,N-dimethyl-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | 1-(2-ethoxyethyl)-N,N-dimethyl-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70707341 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-(2-ethoxyethyl)-N,N-dimethyl-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | CCOCCn1c(=O)[nH]c2cc(C(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C14H19N3O3/c1-4-20-8-7-17-12-6-5-10(13(18)16(2)3)9-11(12)15-14(17)19/h5-6,9H,4,7-8H2,1-3H3,(H,15,19) |
| InChIKey | HLTOVEPWDMPMLK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|