C15H19N7O3 — CID 70726471
N-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]-1-(2-ethoxyethyl)-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 70726471) has the molecular formula C15H19N7O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]-1-(2-ethoxyethyl)-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]-1-(2-ethoxyethyl)-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70726471 |
| Molecular Formula | C15H19N7O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[(3-amino-1H-1,2,4-triazol-5-yl)methyl]-1-(2-ethoxyethyl)-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | CCOCCn1c(=O)[nH]c2cc(C(=O)NCc3nc(N)n[nH]3)ccc21 |
| InChI | InChI=1S/C15H19N7O3/c1-2-25-6-5-22-11-4-3-9(7-10(11)18-15(22)24)13(23)17-8-12-19-14(16)21-20-12/h3-4,7H,2,5-6,8H2,1H3,(H,17,23)(H,18,24)(H3,16,19,20,21) |
| InChIKey | WQZLZMWHUPJGTA-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|