C21H15F4NO4S — CID 110166788
4-[(2-fluorophenyl)methoxy]-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide (PubChem CID 110166788) has the molecular formula C21H15F4NO4S and a molecular weight of 453.41 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methoxy]-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide.
| Compound Name | 4-[(2-fluorophenyl)methoxy]-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 110166788 |
| Molecular Formula | C21H15F4NO4S |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 4-[(2-fluorophenyl)methoxy]-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H15F4NO4S/c22-19-7-2-1-4-15(19)13-30-17-10-8-14(9-11-17)20(27)26-31(28,29)18-6-3-5-16(12-18)21(23,24)25/h1-12H,13H2,(H,26,27) |
| InChIKey | BFBVQNANLRBKND-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |