C23H17F3N2O4S — CID 134121314
5-phenylmethoxy-N-[3-(trifluoromethyl)phenyl]sulfonylindole-1-carboxamide (PubChem CID 134121314) has the molecular formula C23H17F3N2O4S and a molecular weight of 474.46 g/mol. Its IUPAC name is 5-phenylmethoxy-N-[3-(trifluoromethyl)phenyl]sulfonylindole-1-carboxamide.
| Compound Name | 5-phenylmethoxy-N-[3-(trifluoromethyl)phenyl]sulfonylindole-1-carboxamide |
|---|---|
| PubChem CID | 134121314 |
| Molecular Formula | C23H17F3N2O4S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 5-phenylmethoxy-N-[3-(trifluoromethyl)phenyl]sulfonylindole-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cccc(C(F)(F)F)c1)n1ccc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C23H17F3N2O4S/c24-23(25,26)18-7-4-8-20(14-18)33(30,31)27-22(29)28-12-11-17-13-19(9-10-21(17)28)32-15-16-5-2-1-3-6-16/h1-14H,15H2,(H,27,29) |
| InChIKey | ZGYDCEXHICMYAX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |