C21H15ClF3NO4S — CID 110077557
2-[(4-chlorophenyl)methoxy]-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide (PubChem CID 110077557) has the molecular formula C21H15ClF3NO4S and a molecular weight of 469.87 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methoxy]-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide.
| Compound Name | 2-[(4-chlorophenyl)methoxy]-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 110077557 |
| Molecular Formula | C21H15ClF3NO4S |
| Molecular Weight | 469.87 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methoxy]-N-[3-(trifluoromethyl)phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15ClF3NO4S/c22-16-10-8-14(9-11-16)13-30-19-7-2-1-6-18(19)20(27)26-31(28,29)17-5-3-4-15(12-17)21(23,24)25/h1-12H,13H2,(H,26,27) |
| InChIKey | CJAMTEUOZVYJDC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |