C20H15Cl2NO4S — CID 110161772
2-[(3-chlorophenyl)methoxy]-N-(4-chlorophenyl)sulfonylbenzamide (PubChem CID 110161772) has the molecular formula C20H15Cl2NO4S and a molecular weight of 436.32 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methoxy]-N-(4-chlorophenyl)sulfonylbenzamide.
| Compound Name | 2-[(3-chlorophenyl)methoxy]-N-(4-chlorophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 110161772 |
| Molecular Formula | C20H15Cl2NO4S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 2-[(3-chlorophenyl)methoxy]-N-(4-chlorophenyl)sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2NO4S/c21-15-8-10-17(11-9-15)28(25,26)23-20(24)18-6-1-2-7-19(18)27-13-14-4-3-5-16(22)12-14/h1-12H,13H2,(H,23,24) |
| InChIKey | AZBDQYSYUQEKLO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |