C15H19NO4S — CID 101084497
5-methylhexa-3,4-dienyl N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 101084497) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 5-methylhexa-3,4-dienyl N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | 5-methylhexa-3,4-dienyl N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 101084497 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 5-methylhexa-3,4-dienyl N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | CC(C)=C=CCCOC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-12(2)6-4-5-11-20-15(17)16-21(18,19)14-9-7-13(3)8-10-14/h4,7-10H,5,11H2,1-3H3,(H,16,17) |
| InChIKey | AMHCHMNRNYEUOZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|