C11H12N2O4S — CID 101122672
2-cyanoethyl N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 101122672) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-cyanoethyl N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | 2-cyanoethyl N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 101122672 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-cyanoethyl N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)OCCC#N)cc1 |
| InChI | InChI=1S/C11H12N2O4S/c1-9-3-5-10(6-4-9)18(15,16)13-11(14)17-8-2-7-12/h3-6H,2,8H2,1H3,(H,13,14) |
| InChIKey | FQGRCHJHKBNCTI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|