C13H16N2O3S2 — CID 96695390
2-(3-cyanopropylsulfanyl)-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 96695390) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-(3-cyanopropylsulfanyl)-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | 2-(3-cyanopropylsulfanyl)-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 96695390 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-(3-cyanopropylsulfanyl)-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)CSCCCC#N)cc1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-11-4-6-12(7-5-11)20(17,18)15-13(16)10-19-9-3-2-8-14/h4-7H,2-3,9-10H2,1H3,(H,15,16) |
| InChIKey | AFBDEGBMIFVSJL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|