C11H14N2O7S2 — CID 25129673
2-[2-[[4-(hydroxymethyl)phenyl]sulfonylamino]-2-oxoethyl]sulfanylethyl nitrate (PubChem CID 25129673) has the molecular formula C11H14N2O7S2 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[2-[[4-(hydroxymethyl)phenyl]sulfonylamino]-2-oxoethyl]sulfanylethyl nitrate.
| Compound Name | 2-[2-[[4-(hydroxymethyl)phenyl]sulfonylamino]-2-oxoethyl]sulfanylethyl nitrate |
|---|---|
| PubChem CID | 25129673 |
| Molecular Formula | C11H14N2O7S2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-[2-[[4-(hydroxymethyl)phenyl]sulfonylamino]-2-oxoethyl]sulfanylethyl nitrate |
| SMILES | O=C(CSCCO[N+](=O)[O-])NS(=O)(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C11H14N2O7S2/c14-7-9-1-3-10(4-2-9)22(18,19)12-11(15)8-21-6-5-20-13(16)17/h1-4,14H,5-8H2,(H,12,15) |
| InChIKey | QUVUJYZVDCPEBB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|