C21H26N2O2S2 — CID 135064875
N-[(3R)-7-cyano-1-phenylsulfanylheptan-3-yl]-4-methylbenzenesulfonamide (PubChem CID 135064875) has the molecular formula C21H26N2O2S2 and a molecular weight of 402.59 g/mol. Its IUPAC name is N-[(3R)-7-cyano-1-phenylsulfanylheptan-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3R)-7-cyano-1-phenylsulfanylheptan-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135064875 |
| Molecular Formula | C21H26N2O2S2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[(3R)-7-cyano-1-phenylsulfanylheptan-3-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CCCCC#N)CCSc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O2S2/c1-18-11-13-21(14-12-18)27(24,25)23-19(8-4-3-7-16-22)15-17-26-20-9-5-2-6-10-20/h2,5-6,9-14,19,23H,3-4,7-8,15,17H2,1H3/t19-/m1/s1 |
| InChIKey | CIEZSRHFUCEKIS-LJQANCHMSA-N |
| XLogP | 4.91 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|