C22H22O4S3 — CID 14066485
1-[3,3-bis(benzenesulfonyl)propylsulfanyl]-4-methylbenzene (PubChem CID 14066485) has the molecular formula C22H22O4S3 and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[3,3-bis(benzenesulfonyl)propylsulfanyl]-4-methylbenzene.
| Compound Name | 1-[3,3-bis(benzenesulfonyl)propylsulfanyl]-4-methylbenzene |
|---|---|
| PubChem CID | 14066485 |
| Molecular Formula | C22H22O4S3 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-[3,3-bis(benzenesulfonyl)propylsulfanyl]-4-methylbenzene |
| SMILES | Cc1ccc(SCCC(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22O4S3/c1-18-12-14-19(15-13-18)27-17-16-22(28(23,24)20-8-4-2-5-9-20)29(25,26)21-10-6-3-7-11-21/h2-15,22H,16-17H2,1H3 |
| InChIKey | IJLIVQFDCWHAON-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |