C24H26O5S3 — CID 14066493
1-[5,5-bis(benzenesulfonyl)pentylsulfanyl]-3-methoxybenzene (PubChem CID 14066493) has the molecular formula C24H26O5S3 and a molecular weight of 490.67 g/mol. Its IUPAC name is 1-[5,5-bis(benzenesulfonyl)pentylsulfanyl]-3-methoxybenzene.
| Compound Name | 1-[5,5-bis(benzenesulfonyl)pentylsulfanyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 14066493 |
| Molecular Formula | C24H26O5S3 |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 1-[5,5-bis(benzenesulfonyl)pentylsulfanyl]-3-methoxybenzene |
| SMILES | COc1cccc(SCCCCC(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H26O5S3/c1-29-20-11-10-12-21(19-20)30-18-9-8-17-24(31(25,26)22-13-4-2-5-14-22)32(27,28)23-15-6-3-7-16-23/h2-7,10-16,19,24H,8-9,17-18H2,1H3 |
| InChIKey | NRWCWMUMQXOICF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|