C13H18O2S — CID 104623576
6-(3-methoxyphenyl)sulfanylhexan-3-one (PubChem CID 104623576) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)sulfanylhexan-3-one.
| Compound Name | 6-(3-methoxyphenyl)sulfanylhexan-3-one |
|---|---|
| PubChem CID | 104623576 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 6-(3-methoxyphenyl)sulfanylhexan-3-one |
| SMILES | CCC(=O)CCCSc1cccc(OC)c1 |
| InChI | InChI=1S/C13H18O2S/c1-3-11(14)6-5-9-16-13-8-4-7-12(10-13)15-2/h4,7-8,10H,3,5-6,9H2,1-2H3 |
| InChIKey | UVEVUUZTDCPYNR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|