C16H27NO2S — CID 106810884
2-ethyl-2-(ethylamino)-5-(3-methoxyphenyl)sulfanylpentan-1-ol (PubChem CID 106810884) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-(3-methoxyphenyl)sulfanylpentan-1-ol.
| Compound Name | 2-ethyl-2-(ethylamino)-5-(3-methoxyphenyl)sulfanylpentan-1-ol |
|---|---|
| PubChem CID | 106810884 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-(3-methoxyphenyl)sulfanylpentan-1-ol |
| SMILES | CCNC(CC)(CO)CCCSc1cccc(OC)c1 |
| InChI | InChI=1S/C16H27NO2S/c1-4-16(13-18,17-5-2)10-7-11-20-15-9-6-8-14(12-15)19-3/h6,8-9,12,17-18H,4-5,7,10-11,13H2,1-3H3 |
| InChIKey | LEPQSEOGXKEBSD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|