C11H17NO2S — CID 64813407
1-amino-4-(3-methoxyphenyl)sulfanylbutan-2-ol (PubChem CID 64813407) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-amino-4-(3-methoxyphenyl)sulfanylbutan-2-ol.
| Compound Name | 1-amino-4-(3-methoxyphenyl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 64813407 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-amino-4-(3-methoxyphenyl)sulfanylbutan-2-ol |
| SMILES | COc1cccc(SCCC(O)CN)c1 |
| InChI | InChI=1S/C11H17NO2S/c1-14-10-3-2-4-11(7-10)15-6-5-9(13)8-12/h2-4,7,9,13H,5-6,8,12H2,1H3 |
| InChIKey | GHYYDAAFGFJNTD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |