C21H19ClO4S3 — CID 14066482
1-[3,3-bis(benzenesulfonyl)propylsulfanyl]-3-chlorobenzene (PubChem CID 14066482) has the molecular formula C21H19ClO4S3 and a molecular weight of 467.03 g/mol. Its IUPAC name is 1-[3,3-bis(benzenesulfonyl)propylsulfanyl]-3-chlorobenzene.
| Compound Name | 1-[3,3-bis(benzenesulfonyl)propylsulfanyl]-3-chlorobenzene |
|---|---|
| PubChem CID | 14066482 |
| Molecular Formula | C21H19ClO4S3 |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 1-[3,3-bis(benzenesulfonyl)propylsulfanyl]-3-chlorobenzene |
| SMILES | O=S(=O)(c1ccccc1)C(CCSc1cccc(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19ClO4S3/c22-17-8-7-9-18(16-17)27-15-14-21(28(23,24)19-10-3-1-4-11-19)29(25,26)20-12-5-2-6-13-20/h1-13,16,21H,14-15H2 |
| InChIKey | CJQSUKREUBQQCX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |