C9H10ClNO2S — CID 62647718
2-amino-3-(3-chlorophenyl)sulfanylpropanoic acid (PubChem CID 62647718) has the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. Its IUPAC name is 2-amino-3-(3-chlorophenyl)sulfanylpropanoic acid.
| Compound Name | 2-amino-3-(3-chlorophenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 62647718 |
| Molecular Formula | C9H10ClNO2S |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 2-amino-3-(3-chlorophenyl)sulfanylpropanoic acid |
| SMILES | NC(CSc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C9H10ClNO2S/c10-6-2-1-3-7(4-6)14-5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13) |
| InChIKey | VQYLCIBXTWCLIN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |