C14H12ClF2NS — CID 66148494
2-(3-chlorophenyl)sulfanyl-1-(2,4-difluorophenyl)ethanamine (PubChem CID 66148494) has the molecular formula C14H12ClF2NS and a molecular weight of 299.77 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-1-(2,4-difluorophenyl)ethanamine.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-1-(2,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 66148494 |
| Molecular Formula | C14H12ClF2NS |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-1-(2,4-difluorophenyl)ethanamine |
| SMILES | NC(CSc1cccc(Cl)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H12ClF2NS/c15-9-2-1-3-11(6-9)19-8-14(18)12-5-4-10(16)7-13(12)17/h1-7,14H,8,18H2 |
| InChIKey | RQFZCNCUVFONFL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |