C14H12BrCl2NS — CID 66159806
2-(3-bromophenyl)sulfanyl-1-(2,5-dichlorophenyl)ethanamine (PubChem CID 66159806) has the molecular formula C14H12BrCl2NS and a molecular weight of 377.13 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-1-(2,5-dichlorophenyl)ethanamine.
| Compound Name | 2-(3-bromophenyl)sulfanyl-1-(2,5-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 66159806 |
| Molecular Formula | C14H12BrCl2NS |
| Molecular Weight | 377.13 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-1-(2,5-dichlorophenyl)ethanamine |
| SMILES | NC(CSc1cccc(Br)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12BrCl2NS/c15-9-2-1-3-11(6-9)19-8-14(18)12-7-10(16)4-5-13(12)17/h1-7,14H,8,18H2 |
| InChIKey | WHHXKGWRNOHUFB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.13 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |