C10H13ClO2S — CID 104827170
4-(3-chlorophenyl)sulfanylbutane-1,3-diol (PubChem CID 104827170) has the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfanylbutane-1,3-diol.
| Compound Name | 4-(3-chlorophenyl)sulfanylbutane-1,3-diol |
|---|---|
| PubChem CID | 104827170 |
| Molecular Formula | C10H13ClO2S |
| Molecular Weight | 232.73 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 4-(3-chlorophenyl)sulfanylbutane-1,3-diol |
| SMILES | OCCC(O)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H13ClO2S/c11-8-2-1-3-10(6-8)14-7-9(13)4-5-12/h1-3,6,9,12-13H,4-5,7H2 |
| InChIKey | KMEIWHSKGMSHEN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |