C19H23Cl2N2OS+ — CID 6986712
(2R)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(3-chlorophenyl)sulfanylpropan-2-ol (PubChem CID 6986712) has the molecular formula C19H23Cl2N2OS+ and a molecular weight of 398.38 g/mol. Its IUPAC name is (2R)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(3-chlorophenyl)sulfanylpropan-2-ol.
| Compound Name | (2R)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(3-chlorophenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 6986712 |
| Molecular Formula | C19H23Cl2N2OS+ |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (2R)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(3-chlorophenyl)sulfanylpropan-2-ol |
| SMILES | O[C@@H](CSc1cccc(Cl)c1)C[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H22Cl2N2OS/c20-15-3-1-5-17(11-15)23-9-7-22(8-10-23)13-18(24)14-25-19-6-2-4-16(21)12-19/h1-6,11-12,18,24H,7-10,13-14H2/p+1/t18-/m1/s1 |
| InChIKey | PTLBRGFSIHPASR-GOSISDBHSA-O |
| XLogP | 2.85 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |