C25H28ClN2O+ — CID 56927865
3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-1,1-diphenylpropan-2-ol (PubChem CID 56927865) has the molecular formula C25H28ClN2O+ and a molecular weight of 407.97 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-1,1-diphenylpropan-2-ol.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-1,1-diphenylpropan-2-ol |
|---|---|
| PubChem CID | 56927865 |
| Molecular Formula | C25H28ClN2O+ |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-1,1-diphenylpropan-2-ol |
| SMILES | OC(C[NH+]1CCN(c2cccc(Cl)c2)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27ClN2O/c26-22-12-7-13-23(18-22)28-16-14-27(15-17-28)19-24(29)25(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18,24-25,29H,14-17,19H2/p+1 |
| InChIKey | QJHCTHPYUOXOGM-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |