C17H26ClN2+ — CID 6938406
1-(3-chlorophenyl)-4-(cyclohexylmethyl)piperazin-4-ium (PubChem CID 6938406) has the molecular formula C17H26ClN2+ and a molecular weight of 293.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(cyclohexylmethyl)piperazin-4-ium.
| Compound Name | 1-(3-chlorophenyl)-4-(cyclohexylmethyl)piperazin-4-ium |
|---|---|
| PubChem CID | 6938406 |
| Molecular Formula | C17H26ClN2+ |
| Molecular Weight | 293.86 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(cyclohexylmethyl)piperazin-4-ium |
| SMILES | Clc1cccc(N2CC[NH+](CC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C17H25ClN2/c18-16-7-4-8-17(13-16)20-11-9-19(10-12-20)14-15-5-2-1-3-6-15/h4,7-8,13,15H,1-3,5-6,9-12,14H2/p+1 |
| InChIKey | LURULLLGHVHCRF-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.86 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |