C18H21BrClN2O+ — CID 7036655
(1S)-1-(4-bromophenyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]ethanol (PubChem CID 7036655) has the molecular formula C18H21BrClN2O+ and a molecular weight of 396.74 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]ethanol.
| Compound Name | (1S)-1-(4-bromophenyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 7036655 |
| Molecular Formula | C18H21BrClN2O+ |
| Molecular Weight | 396.74 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | (1S)-1-(4-bromophenyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]ethanol |
| SMILES | O[C@H](C[NH+]1CCN(c2cccc(Cl)c2)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20BrClN2O/c19-15-6-4-14(5-7-15)18(23)13-21-8-10-22(11-9-21)17-3-1-2-16(20)12-17/h1-7,12,18,23H,8-11,13H2/p+1/t18-/m1/s1 |
| InChIKey | FBLXGXZXGWUZBO-GOSISDBHSA-O |
| XLogP | 2.54 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |