C20H26ClN2O2+ — CID 7390288
(2R)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 7390288) has the molecular formula C20H26ClN2O2+ and a molecular weight of 361.89 g/mol. Its IUPAC name is (2R)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 7390288 |
| Molecular Formula | C20H26ClN2O2+ |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (2R)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccccc1OC[C@H](O)C[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-16-5-2-3-8-20(16)25-15-19(24)14-22-9-11-23(12-10-22)18-7-4-6-17(21)13-18/h2-8,13,19,24H,9-12,14-15H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | IPJVDSNRAKNVFU-LJQANCHMSA-O |
| XLogP | 1.79 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |