C23H30ClN2O2+ — CID 6989007
(2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol (PubChem CID 6989007) has the molecular formula C23H30ClN2O2+ and a molecular weight of 401.96 g/mol. Its IUPAC name is (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 6989007 |
| Molecular Formula | C23H30ClN2O2+ |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol |
| SMILES | C=CCc1ccccc1OC[C@H](O)C[NH+]1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C23H29ClN2O2/c1-3-6-19-7-4-5-8-23(19)28-17-21(27)16-25-11-13-26(14-12-25)22-15-20(24)10-9-18(22)2/h3-5,7-10,15,21,27H,1,6,11-14,16-17H2,2H3/p+1/t21-/m1/s1 |
| InChIKey | SAMUCOGWEOWWGS-OAQYLSRUSA-O |
| XLogP | 2.52 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|