C17H28ClN2O2+ — CID 4744349
1-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-3-propan-2-yloxypropan-2-ol (PubChem CID 4744349) has the molecular formula C17H28ClN2O2+ and a molecular weight of 327.88 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 4744349 |
| Molecular Formula | C17H28ClN2O2+ |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]-3-propan-2-yloxypropan-2-ol |
| SMILES | Cc1ccc(Cl)cc1N1CC[NH+](CC(O)COC(C)C)CC1 |
| InChI | InChI=1S/C17H27ClN2O2/c1-13(2)22-12-16(21)11-19-6-8-20(9-7-19)17-10-15(18)5-4-14(17)3/h4-5,10,13,16,21H,6-9,11-12H2,1-3H3/p+1 |
| InChIKey | FOICDFLCFWTYPY-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |