C17H28N2O2+2 — CID 7421058
(2S)-1-(4-methyl-2-prop-2-enylphenoxy)-3-piperazine-1,4-diium-1-ylpropan-2-ol (PubChem CID 7421058) has the molecular formula C17H28N2O2+2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (2S)-1-(4-methyl-2-prop-2-enylphenoxy)-3-piperazine-1,4-diium-1-ylpropan-2-ol.
| Compound Name | (2S)-1-(4-methyl-2-prop-2-enylphenoxy)-3-piperazine-1,4-diium-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 7421058 |
| Molecular Formula | C17H28N2O2+2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | (2S)-1-(4-methyl-2-prop-2-enylphenoxy)-3-piperazine-1,4-diium-1-ylpropan-2-ol |
| SMILES | C=CCc1cc(C)ccc1OC[C@@H](O)C[NH+]1CC[NH2+]CC1 |
| InChI | InChI=1S/C17H26N2O2/c1-3-4-15-11-14(2)5-6-17(15)21-13-16(20)12-19-9-7-18-8-10-19/h3,5-6,11,16,18,20H,1,4,7-10,12-13H2,2H3/p+2/t16-/m0/s1 |
| InChIKey | ZKAOFRNFIUCJQW-INIZCTEOSA-P |
| XLogP | -1.07 |
| TPSA | 50.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|