C19H23ClN3O4+ — CID 6980328
(2S)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(2-nitrophenoxy)propan-2-ol (PubChem CID 6980328) has the molecular formula C19H23ClN3O4+ and a molecular weight of 392.86 g/mol. Its IUPAC name is (2S)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(2-nitrophenoxy)propan-2-ol.
| Compound Name | (2S)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(2-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 6980328 |
| Molecular Formula | C19H23ClN3O4+ |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (2S)-1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-(2-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1ccccc1OC[C@@H](O)C[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H22ClN3O4/c20-15-4-3-5-16(12-15)22-10-8-21(9-11-22)13-17(24)14-27-19-7-2-1-6-18(19)23(25)26/h1-7,12,17,24H,8-11,13-14H2/p+1/t17-/m0/s1 |
| InChIKey | FIDGVROMRQUMQG-KRWDZBQOSA-O |
| XLogP | 1.39 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|