C18H20BrClN3O+ — CID 6958467
N-(4-bromophenyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 6958467) has the molecular formula C18H20BrClN3O+ and a molecular weight of 409.74 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 6958467 |
| Molecular Formula | C18H20BrClN3O+ |
| Molecular Weight | 409.74 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-(4-bromophenyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2cccc(Cl)c2)CC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H19BrClN3O/c19-14-4-6-16(7-5-14)21-18(24)13-22-8-10-23(11-9-22)17-3-1-2-15(20)12-17/h1-7,12H,8-11,13H2,(H,21,24)/p+1 |
| InChIKey | SAEMEJXJPBESQO-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |