C16H19ClN5O+ — CID 8542873
N-(3-chlorophenyl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8542873) has the molecular formula C16H19ClN5O+ and a molecular weight of 332.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8542873 |
| Molecular Formula | C16H19ClN5O+ |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(3-chlorophenyl)-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ncccn2)CC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18ClN5O/c17-13-3-1-4-14(11-13)20-15(23)12-21-7-9-22(10-8-21)16-18-5-2-6-19-16/h1-6,11H,7-10,12H2,(H,20,23)/p+1 |
| InChIKey | WBMUUMYQFHCQPX-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |