C18H23ClN5O+ — CID 8542425
N-[(1S)-1-(4-chlorophenyl)ethyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8542425) has the molecular formula C18H23ClN5O+ and a molecular weight of 360.87 g/mol. Its IUPAC name is N-[(1S)-1-(4-chlorophenyl)ethyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8542425 |
| Molecular Formula | C18H23ClN5O+ |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | C[C@H](NC(=O)C[NH+]1CCN(c2ncccn2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN5O/c1-14(15-3-5-16(19)6-4-15)22-17(25)13-23-9-11-24(12-10-23)18-20-7-2-8-21-18/h2-8,14H,9-13H2,1H3,(H,22,25)/p+1/t14-/m0/s1 |
| InChIKey | CKZCWYMZUBYTFX-AWEZNQCLSA-O |
| XLogP | 0.71 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |