C20H25BrN3O+ — CID 3494423
N-(4-bromophenyl)-2-[4-(4-ethylphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 3494423) has the molecular formula C20H25BrN3O+ and a molecular weight of 403.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[4-(4-ethylphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[4-(4-ethylphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 3494423 |
| Molecular Formula | C20H25BrN3O+ |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-(4-bromophenyl)-2-[4-(4-ethylphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CCc1ccc(N2CC[NH+](CC(=O)Nc3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H24BrN3O/c1-2-16-3-9-19(10-4-16)24-13-11-23(12-14-24)15-20(25)22-18-7-5-17(21)6-8-18/h3-10H,2,11-15H2,1H3,(H,22,25)/p+1 |
| InChIKey | MGLWAUBETXIINB-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|