C19H23BrN3O+ — CID 7106083
4-bromo-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]benzamide (PubChem CID 7106083) has the molecular formula C19H23BrN3O+ and a molecular weight of 389.32 g/mol. Its IUPAC name is 4-bromo-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]benzamide.
| Compound Name | 4-bromo-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 7106083 |
| Molecular Formula | C19H23BrN3O+ |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-bromo-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]benzamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)c3ccc(Br)cc3)cc2)CC1 |
| InChI | InChI=1S/C19H22BrN3O/c1-2-22-11-13-23(14-12-22)18-9-7-17(8-10-18)21-19(24)15-3-5-16(20)6-4-15/h3-10H,2,11-14H2,1H3,(H,21,24)/p+1 |
| InChIKey | DGWSZCRTNVDOBI-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|