C23H27N4O+ — CID 9326856
N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-pyrrol-1-ylbenzamide (PubChem CID 9326856) has the molecular formula C23H27N4O+ and a molecular weight of 375.50 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-pyrrol-1-ylbenzamide.
| Compound Name | N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 9326856 |
| Molecular Formula | C23H27N4O+ |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-pyrrol-1-ylbenzamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)c3cccc(-n4cccc4)c3)cc2)CC1 |
| InChI | InChI=1S/C23H26N4O/c1-2-25-14-16-27(17-15-25)21-10-8-20(9-11-21)24-23(28)19-6-5-7-22(18-19)26-12-3-4-13-26/h3-13,18H,2,14-17H2,1H3,(H,24,28)/p+1 |
| InChIKey | CCEAAEVZVSJTQW-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 41.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|