C22H31N4O+ — CID 9298756
1-cyclopropyl-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 9298756) has the molecular formula C22H31N4O+ and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-cyclopropyl-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-cyclopropyl-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 9298756 |
| Molecular Formula | C22H31N4O+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 1-cyclopropyl-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)c3cc(C)n(C4CC4)c3C)cc2)CC1 |
| InChI | InChI=1S/C22H30N4O/c1-4-24-11-13-25(14-12-24)19-7-5-18(6-8-19)23-22(27)21-15-16(2)26(17(21)3)20-9-10-20/h5-8,15,20H,4,9-14H2,1-3H3,(H,23,27)/p+1 |
| InChIKey | HVPFADKLRYHIOX-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 41.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|