C23H28ClN4O2+ — CID 9291780
4-chloro-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 9291780) has the molecular formula C23H28ClN4O2+ and a molecular weight of 427.96 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | 4-chloro-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 9291780 |
| Molecular Formula | C23H28ClN4O2+ |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-chloro-N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)c3ccc(Cl)cc3N3CCCC3=O)cc2)CC1 |
| InChI | InChI=1S/C23H27ClN4O2/c1-2-26-12-14-27(15-13-26)19-8-6-18(7-9-19)25-23(30)20-10-5-17(24)16-21(20)28-11-3-4-22(28)29/h5-10,16H,2-4,11-15H2,1H3,(H,25,30)/p+1 |
| InChIKey | WIHYCHZHTNOGOM-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|