C22H28BrN3O3 — CID 160949316
N-(4-bromophenyl)-4-piperazin-1-ylbenzamide;tert-butyl formate (PubChem CID 160949316) has the molecular formula C22H28BrN3O3 and a molecular weight of 462.39 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-piperazin-1-ylbenzamide;tert-butyl formate.
| Compound Name | N-(4-bromophenyl)-4-piperazin-1-ylbenzamide;tert-butyl formate |
|---|---|
| PubChem CID | 160949316 |
| Molecular Formula | C22H28BrN3O3 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-(4-bromophenyl)-4-piperazin-1-ylbenzamide;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.O=C(Nc1ccc(Br)cc1)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C17H18BrN3O.C5H10O2/c18-14-3-5-15(6-4-14)20-17(22)13-1-7-16(8-2-13)21-11-9-19-10-12-21;1-5(2,3)7-4-6/h1-8,19H,9-12H2,(H,20,22);4H,1-3H3 |
| InChIKey | SVNSTDVQBGJGDX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|